C14H12BrF2NO — CID 102854845
1-(5-bromo-2,4-difluorophenyl)-4,5,6,7-tetrahydroindol-4-ol (PubChem CID 102854845) has the molecular formula C14H12BrF2NO and a molecular weight of 328.16 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-4,5,6,7-tetrahydroindol-4-ol.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
|---|---|
| PubChem CID | 102854845 |
| Molecular Formula | C14H12BrF2NO |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-4,5,6,7-tetrahydroindol-4-ol |
| SMILES | OC1CCCc2c1ccn2-c1cc(Br)c(F)cc1F |
| InChI | InChI=1S/C14H12BrF2NO/c15-9-6-13(11(17)7-10(9)16)18-5-4-8-12(18)2-1-3-14(8)19/h4-7,14,19H,1-3H2 |
| InChIKey | VGHADPHZKMSDJX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|