C7H6BrF2N3O — CID 102855074
2-(5-bromo-2,4-difluorophenyl)-1-hydroxyguanidine (PubChem CID 102855074) has the molecular formula C7H6BrF2N3O and a molecular weight of 266.05 g/mol. Its IUPAC name is 2-(5-bromo-2,4-difluorophenyl)-1-hydroxyguanidine.
| Compound Name | 2-(5-bromo-2,4-difluorophenyl)-1-hydroxyguanidine |
|---|---|
| PubChem CID | 102855074 |
| Molecular Formula | C7H6BrF2N3O |
| Molecular Weight | 266.05 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 2-(5-bromo-2,4-difluorophenyl)-1-hydroxyguanidine |
| SMILES | N/C(=N\c1cc(Br)c(F)cc1F)NO |
| InChI | InChI=1S/C7H6BrF2N3O/c8-3-1-6(12-7(11)13-14)5(10)2-4(3)9/h1-2,14H,(H3,11,12,13) |
| InChIKey | PIEVOGZTVYQRTN-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.05 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|