C8H15F2NO2S — CID 102868282
N-(1,1-difluoropropan-2-yl)-1,1-dioxothian-4-amine (PubChem CID 102868282) has the molecular formula C8H15F2NO2S and a molecular weight of 227.28 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-1,1-dioxothian-4-amine.
| Compound Name | N-(1,1-difluoropropan-2-yl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 102868282 |
| Molecular Formula | C8H15F2NO2S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-1,1-dioxothian-4-amine |
| SMILES | CC(NC1CCS(=O)(=O)CC1)C(F)F |
| InChI | InChI=1S/C8H15F2NO2S/c1-6(8(9)10)11-7-2-4-14(12,13)5-3-7/h6-8,11H,2-5H2,1H3 |
| InChIKey | IBTZLPREOJKVNH-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |