About 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol
1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol (PubChem CID 102869547) has the molecular formula C8H15F2NO
and a molecular weight of 179.21 g/mol. Its IUPAC name is 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol.
Analyze 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol?
The IUPAC name of 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol (CID 102869547) is 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol.
What is the SMILES notation for 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol?
The canonical SMILES for 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol is CC(NCC(O)C1CC1)C(F)F.
What is the InChIKey of 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol?
The InChIKey is TXTQYIMSZGWQFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2NO/c1-5(8(9)10)11-4-7(12)6-2-3-6/h5-8,11-12H,2-4H2,1H3.
What are the key properties of 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol?
1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol has a molecular weight of 179.21 g/mol, XLogP of 1.00, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(1,1-difluoropropan-2-ylamino)ethanol is sourced from PubChem (CID 102869547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).