C10H21N5O2 — CID 102888038
N-amino-N'-(2-methoxyethyl)-4-methyl-3-oxo-1,4-diazepane-1-carboximidamide (PubChem CID 102888038) has the molecular formula C10H21N5O2 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-amino-N'-(2-methoxyethyl)-4-methyl-3-oxo-1,4-diazepane-1-carboximidamide.
| Compound Name | N-amino-N'-(2-methoxyethyl)-4-methyl-3-oxo-1,4-diazepane-1-carboximidamide |
|---|---|
| PubChem CID | 102888038 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N-amino-N'-(2-methoxyethyl)-4-methyl-3-oxo-1,4-diazepane-1-carboximidamide |
| SMILES | COCC/N=C(\NN)N1CCCN(C)C(=O)C1 |
| InChI | InChI=1S/C10H21N5O2/c1-14-5-3-6-15(8-9(14)16)10(13-11)12-4-7-17-2/h3-8,11H2,1-2H3,(H,12,13) |
| InChIKey | VTHUJBVGUIDFMV-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|