C11H21NO3S — CID 102888073
4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-ol (PubChem CID 102888073) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-ol.
| Compound Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102888073 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)cyclohexan-1-ol |
| SMILES | CC1CS(=O)(=O)CCN1C1CCC(O)CC1 |
| InChI | InChI=1S/C11H21NO3S/c1-9-8-16(14,15)7-6-12(9)10-2-4-11(13)5-3-10/h9-11,13H,2-8H2,1H3 |
| InChIKey | LVJMKVQQAODPIX-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |