About ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide
ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide (PubChem CID 176696563) has the molecular formula C15H33NO2S
and a molecular weight of 291.50 g/mol. Its IUPAC name is ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
| PubChem CID | 176696563 |
| Molecular Formula | C15H33NO2S |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
| SMILES | CC.CC.COC1CCC(N2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C11H21NO2S.2C2H6/c1-14-11-4-2-10(3-5-11)12-6-8-15(13)9-7-12;2*1-2/h10-11H,2-9H2,1H3;2*1-2H3 |
| InChIKey | CNZBOKNTNHZLLX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide?
The IUPAC name of ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide (CID 176696563) is ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide.
What is the SMILES notation for ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide?
The canonical SMILES for ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide is CC.CC.COC1CCC(N2CCS(=O)CC2)CC1.
What is the InChIKey of ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide?
The InChIKey is CNZBOKNTNHZLLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO2S.2C2H6/c1-14-11-4-2-10(3-5-11)12-6-8-15(13)9-7-12;2*1-2/h10-11H,2-9H2,1H3;2*1-2H3.
What are the key properties of ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide?
ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide has a molecular weight of 291.50 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide is sourced from PubChem (CID 176696563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).