C11H21NO2S — CID 176696564
4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide (PubChem CID 176696564) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide.
| Compound Name | 4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 176696564 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
| SMILES | COC1CCC(N2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C11H21NO2S/c1-14-11-4-2-10(3-5-11)12-6-8-15(13)9-7-12/h10-11H,2-9H2,1H3 |
| InChIKey | ICWSEVYWKWLRJC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |