C13H27NO2S — CID 176696587
ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide (PubChem CID 176696587) has the molecular formula C13H27NO2S and a molecular weight of 261.43 g/mol. Its IUPAC name is ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide.
| Compound Name | ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 176696587 |
| Molecular Formula | C13H27NO2S |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | ethane;4-(4-methoxycyclohexyl)-1,4-thiazinane 1-oxide |
| SMILES | CC.COC1CCC(N2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C11H21NO2S.C2H6/c1-14-11-4-2-10(3-5-11)12-6-8-15(13)9-7-12;1-2/h10-11H,2-9H2,1H3;1-2H3 |
| InChIKey | SHAYUTBKZLMZLV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |