C13H25NO3S — CID 176761201
4-(4-propan-2-yloxycyclohexyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 176761201) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is 4-(4-propan-2-yloxycyclohexyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(4-propan-2-yloxycyclohexyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 176761201 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-(4-propan-2-yloxycyclohexyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CC(C)OC1CCC(N2CCS(=O)(=O)CC2)CC1 |
| InChI | InChI=1S/C13H25NO3S/c1-11(2)17-13-5-3-12(4-6-13)14-7-9-18(15,16)10-8-14/h11-13H,3-10H2,1-2H3 |
| InChIKey | MLKHNWSCODZOKK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |