C19H17NO4S — CID 10291741
ethyl 3-(benzenesulfonyl)-3-cyano-1,2-dihydroindene-1-carboxylate (PubChem CID 10291741) has the molecular formula C19H17NO4S and a molecular weight of 355.42 g/mol. Its IUPAC name is ethyl 3-(benzenesulfonyl)-3-cyano-1,2-dihydroindene-1-carboxylate.
| Compound Name | ethyl 3-(benzenesulfonyl)-3-cyano-1,2-dihydroindene-1-carboxylate |
|---|---|
| PubChem CID | 10291741 |
| Molecular Formula | C19H17NO4S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | ethyl 3-(benzenesulfonyl)-3-cyano-1,2-dihydroindene-1-carboxylate |
| SMILES | CCOC(=O)C1CC(C#N)(S(=O)(=O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H17NO4S/c1-2-24-18(21)16-12-19(13-20,17-11-7-6-10-15(16)17)25(22,23)14-8-4-3-5-9-14/h3-11,16H,2,12H2,1H3 |
| InChIKey | SXLDLVQXNOXBSW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |