C19H21NO4S — CID 139040246
ethyl 2-[(1R,2R,5R)-2-(benzenesulfonyl)-2-cyano-5-prop-2-ynylcyclopentyl]acetate (PubChem CID 139040246) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,5R)-2-(benzenesulfonyl)-2-cyano-5-prop-2-ynylcyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2R,5R)-2-(benzenesulfonyl)-2-cyano-5-prop-2-ynylcyclopentyl]acetate |
|---|---|
| PubChem CID | 139040246 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | ethyl 2-[(1R,2R,5R)-2-(benzenesulfonyl)-2-cyano-5-prop-2-ynylcyclopentyl]acetate |
| SMILES | C#CC[C@H]1CC[C@@](C#N)(S(=O)(=O)c2ccccc2)[C@@H]1CC(=O)OCC |
| InChI | InChI=1S/C19H21NO4S/c1-3-8-15-11-12-19(14-20,17(15)13-18(21)24-4-2)25(22,23)16-9-6-5-7-10-16/h1,5-7,9-10,15,17H,4,8,11-13H2,2H3/t15-,17+,19-/m0/s1 |
| InChIKey | BCGCCHIKCAGXBG-WDYCEAGBSA-N |
| XLogP | 2.73 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|