C16H20O4S — CID 15440527
cis-ethyl (1R,2R)-1-(benzenesulfonyl)-2-ethenylcyclopentane-1-carboxylate (PubChem CID 15440527) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-(benzenesulfonyl)-2-ethenylcyclopentane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-(benzenesulfonyl)-2-ethenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 15440527 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | cis-ethyl (1R,2R)-1-(benzenesulfonyl)-2-ethenylcyclopentane-1-carboxylate |
| SMILES | C=C[C@H]1CCC[C@@]1(C(=O)OCC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-3-13-9-8-12-16(13,15(17)20-4-2)21(18,19)14-10-6-5-7-11-14/h3,5-7,10-11,13H,1,4,8-9,12H2,2H3/t13-,16+/m0/s1 |
| InChIKey | FJFVAVWQGZMTPC-XJKSGUPXSA-N |
| XLogP | 2.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|