C16H20O4S — CID 15632451
ethyl (1R,2S,3R)-3-(benzenesulfonyl)-2-methyl-4-methylidenecyclopentane-1-carboxylate (PubChem CID 15632451) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is ethyl (1R,2S,3R)-3-(benzenesulfonyl)-2-methyl-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | ethyl (1R,2S,3R)-3-(benzenesulfonyl)-2-methyl-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 15632451 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl (1R,2S,3R)-3-(benzenesulfonyl)-2-methyl-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1C[C@@H](C(=O)OCC)[C@H](C)[C@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O4S/c1-4-20-16(17)14-10-11(2)15(12(14)3)21(18,19)13-8-6-5-7-9-13/h5-9,12,14-15H,2,4,10H2,1,3H3/t12-,14+,15-/m0/s1 |
| InChIKey | VFTYAMCQIXOYER-CFVMTHIKSA-N |
| XLogP | 2.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|