C19H19NO4S — CID 10893664
ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-3-phenylbutanoate (PubChem CID 10893664) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-3-phenylbutanoate.
| Compound Name | ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-3-phenylbutanoate |
|---|---|
| PubChem CID | 10893664 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | ethyl (3S,4R)-4-(benzenesulfonyl)-4-cyano-3-phenylbutanoate |
| SMILES | CCOC(=O)C[C@@H](c1ccccc1)[C@H](C#N)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4S/c1-2-24-19(21)13-17(15-9-5-3-6-10-15)18(14-20)25(22,23)16-11-7-4-8-12-16/h3-12,17-18H,2,13H2,1H3/t17-,18-/m0/s1 |
| InChIKey | DJDZLUCBSYZBST-ROUUACIJSA-N |
| XLogP | 3.09 |
| TPSA | 84.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |