C16H22O4S — CID 11066872
ethyl 2-[(1R,2S)-2-(benzenesulfonyl)-2-methylcyclopentyl]acetate (PubChem CID 11066872) has the molecular formula C16H22O4S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl 2-[(1R,2S)-2-(benzenesulfonyl)-2-methylcyclopentyl]acetate.
| Compound Name | ethyl 2-[(1R,2S)-2-(benzenesulfonyl)-2-methylcyclopentyl]acetate |
|---|---|
| PubChem CID | 11066872 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | ethyl 2-[(1R,2S)-2-(benzenesulfonyl)-2-methylcyclopentyl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCC[C@]1(C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O4S/c1-3-20-15(17)12-13-8-7-11-16(13,2)21(18,19)14-9-5-4-6-10-14/h4-6,9-10,13H,3,7-8,11-12H2,1-2H3/t13-,16+/m1/s1 |
| InChIKey | FIELGUPULLDJGR-CJNGLKHVSA-N |
| XLogP | 2.97 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |