C21H22O4S — CID 15632455
ethyl (1S,2S,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenylcyclopentane-1-carboxylate (PubChem CID 15632455) has the molecular formula C21H22O4S and a molecular weight of 370.47 g/mol. Its IUPAC name is ethyl (1S,2S,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenylcyclopentane-1-carboxylate.
| Compound Name | ethyl (1S,2S,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 15632455 |
| Molecular Formula | C21H22O4S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | ethyl (1S,2S,3S)-3-(benzenesulfonyl)-4-methylidene-2-phenylcyclopentane-1-carboxylate |
| SMILES | C=C1C[C@H](C(=O)OCC)[C@@H](c2ccccc2)[C@@H]1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O4S/c1-3-25-21(22)18-14-15(2)20(19(18)16-10-6-4-7-11-16)26(23,24)17-12-8-5-9-13-17/h4-13,18-20H,2-3,14H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | RTYKBQNZISJRIE-XUVXKRRUSA-N |
| XLogP | 3.75 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|