C18H22N4O2S — CID 10291907
N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-[(2-methoxy-1H-imidazol-5-yl)sulfanyl]benzamide (PubChem CID 10291907) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-[(2-methoxy-1H-imidazol-5-yl)sulfanyl]benzamide.
| Compound Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-[(2-methoxy-1H-imidazol-5-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 10291907 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-4-[(2-methoxy-1H-imidazol-5-yl)sulfanyl]benzamide |
| SMILES | COc1ncc(Sc2ccc(C(=O)N[C@H]3CN4CCC3CC4)cc2)[nH]1 |
| InChI | InChI=1S/C18H22N4O2S/c1-24-18-19-10-16(21-18)25-14-4-2-13(3-5-14)17(23)20-15-11-22-8-6-12(15)7-9-22/h2-5,10,12,15H,6-9,11H2,1H3,(H,19,21)(H,20,23)/t15-/m0/s1 |
| InChIKey | QHEIGBVLNHZEOI-HNNXBMFYSA-N |
| XLogP | 2.39 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |