C11H12FNO5S2 — CID 102919495
4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzoic acid (PubChem CID 102919495) has the molecular formula C11H12FNO5S2 and a molecular weight of 321.35 g/mol. Its IUPAC name is 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzoic acid.
| Compound Name | 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 102919495 |
| Molecular Formula | C11H12FNO5S2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 4-fluoro-2-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(F)cc1S(=O)(=O)N1CCS(=O)CC1 |
| InChI | InChI=1S/C11H12FNO5S2/c12-8-1-2-9(11(14)15)10(7-8)20(17,18)13-3-5-19(16)6-4-13/h1-2,7H,3-6H2,(H,14,15) |
| InChIKey | UOFOQAKQUOPHQQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |