C11H11BrN2S — CID 102943319
3-bromo-5-[(2,5-dimethylphenyl)methyl]-1,2,4-thiadiazole (PubChem CID 102943319) has the molecular formula C11H11BrN2S and a molecular weight of 283.19 g/mol. Its IUPAC name is 3-bromo-5-[(2,5-dimethylphenyl)methyl]-1,2,4-thiadiazole.
| Compound Name | 3-bromo-5-[(2,5-dimethylphenyl)methyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943319 |
| Molecular Formula | C11H11BrN2S |
| Molecular Weight | 283.19 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 3-bromo-5-[(2,5-dimethylphenyl)methyl]-1,2,4-thiadiazole |
| SMILES | Cc1ccc(C)c(Cc2nc(Br)ns2)c1 |
| InChI | InChI=1S/C11H11BrN2S/c1-7-3-4-8(2)9(5-7)6-10-13-11(12)14-15-10/h3-5H,6H2,1-2H3 |
| InChIKey | AQZQPZBJKLJORO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |