C9H6ClIN2S — CID 102943546
5-(4-chloro-3-methylphenyl)-3-iodo-1,2,4-thiadiazole (PubChem CID 102943546) has the molecular formula C9H6ClIN2S and a molecular weight of 336.59 g/mol. Its IUPAC name is 5-(4-chloro-3-methylphenyl)-3-iodo-1,2,4-thiadiazole.
| Compound Name | 5-(4-chloro-3-methylphenyl)-3-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943546 |
| Molecular Formula | C9H6ClIN2S |
| Molecular Weight | 336.59 g/mol |
| Exact Mass | 335.90 |
| IUPAC Name | 5-(4-chloro-3-methylphenyl)-3-iodo-1,2,4-thiadiazole |
| SMILES | Cc1cc(-c2nc(I)ns2)ccc1Cl |
| InChI | InChI=1S/C9H6ClIN2S/c1-5-4-6(2-3-7(5)10)8-12-9(11)13-14-8/h2-4H,1H3 |
| InChIKey | XAPLAJIXNWJHRP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|