C9H4Cl2N2O2S — CID 22229287
5-(3,4-dichlorophenyl)-1,2,4-thiadiazole-3-carboxylic acid (PubChem CID 22229287) has the molecular formula C9H4Cl2N2O2S and a molecular weight of 275.12 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-1,2,4-thiadiazole-3-carboxylic acid.
| Compound Name | 5-(3,4-dichlorophenyl)-1,2,4-thiadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 22229287 |
| Molecular Formula | C9H4Cl2N2O2S |
| Molecular Weight | 275.12 g/mol |
| Exact Mass | 273.94 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-1,2,4-thiadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1nsc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C9H4Cl2N2O2S/c10-5-2-1-4(3-6(5)11)8-12-7(9(14)15)13-16-8/h1-3H,(H,14,15) |
| InChIKey | RFSDFJBXDMZRKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.12 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |