C10H9IN2S — CID 102943757
5-(2,4-dimethylphenyl)-3-iodo-1,2,4-thiadiazole (PubChem CID 102943757) has the molecular formula C10H9IN2S and a molecular weight of 316.17 g/mol. Its IUPAC name is 5-(2,4-dimethylphenyl)-3-iodo-1,2,4-thiadiazole.
| Compound Name | 5-(2,4-dimethylphenyl)-3-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 102943757 |
| Molecular Formula | C10H9IN2S |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.95 |
| IUPAC Name | 5-(2,4-dimethylphenyl)-3-iodo-1,2,4-thiadiazole |
| SMILES | Cc1ccc(-c2nc(I)ns2)c(C)c1 |
| InChI | InChI=1S/C10H9IN2S/c1-6-3-4-8(7(2)5-6)9-12-10(11)13-14-9/h3-5H,1-2H3 |
| InChIKey | QRJQNUHSNCTEJF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|