C9H8IN3S — CID 131115490
5-(5,6-dimethyl-2-pyridinyl)-3-iodo-1,2,4-thiadiazole (PubChem CID 131115490) has the molecular formula C9H8IN3S and a molecular weight of 317.16 g/mol. Its IUPAC name is 5-(5,6-dimethyl-2-pyridinyl)-3-iodo-1,2,4-thiadiazole.
| Compound Name | 5-(5,6-dimethyl-2-pyridinyl)-3-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 131115490 |
| Molecular Formula | C9H8IN3S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 5-(5,6-dimethyl-2-pyridinyl)-3-iodo-1,2,4-thiadiazole |
| SMILES | Cc1ccc(-c2nc(I)ns2)nc1C |
| InChI | InChI=1S/C9H8IN3S/c1-5-3-4-7(11-6(5)2)8-12-9(10)13-14-8/h3-4H,1-2H3 |
| InChIKey | NVZHKUFHIJJWIE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|