About dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate
dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate (PubChem CID 102953727) has the molecular formula C13H13NO6
and a molecular weight of 279.25 g/mol. Its IUPAC name is dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate.
Analyze dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate?
The IUPAC name of dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate (CID 102953727) is dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate.
What is the SMILES notation for dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate?
The canonical SMILES for dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate is COC(=O)c1nc(CCc2ccco2)oc1C(=O)OC.
What is the InChIKey of dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate?
The InChIKey is PRESLGNQLVCQTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO6/c1-17-12(15)10-11(13(16)18-2)20-9(14-10)6-5-8-4-3-7-19-8/h3-4,7H,5-6H2,1-2H3.
What are the key properties of dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate?
dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate has a molecular weight of 279.25 g/mol, XLogP of 1.63, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-[2-(furan-2-yl)ethyl]-1,3-oxazole-4,5-dicarboxylate is sourced from PubChem (CID 102953727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).