C11H9NO6 — CID 121005993
dimethyl 4-(furan-2-yl)-1,2-oxazole-3,5-dicarboxylate (PubChem CID 121005993) has the molecular formula C11H9NO6 and a molecular weight of 251.19 g/mol. Its IUPAC name is dimethyl 4-(furan-2-yl)-1,2-oxazole-3,5-dicarboxylate.
| Compound Name | dimethyl 4-(furan-2-yl)-1,2-oxazole-3,5-dicarboxylate |
|---|---|
| PubChem CID | 121005993 |
| Molecular Formula | C11H9NO6 |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 251.04 |
| IUPAC Name | dimethyl 4-(furan-2-yl)-1,2-oxazole-3,5-dicarboxylate |
| SMILES | COC(=O)c1noc(C(=O)OC)c1-c1ccco1 |
| InChI | InChI=1S/C11H9NO6/c1-15-10(13)8-7(6-4-3-5-17-6)9(18-12-8)11(14)16-2/h3-5H,1-2H3 |
| InChIKey | DVBUVCDEAPKGRP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 91.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |