C16H20N4O3 — CID 142340106
methyl 3-amino-5-(azepan-1-yl)-6-(furan-2-yl)pyrazine-2-carboxylate (PubChem CID 142340106) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 3-amino-5-(azepan-1-yl)-6-(furan-2-yl)pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-5-(azepan-1-yl)-6-(furan-2-yl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 142340106 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | methyl 3-amino-5-(azepan-1-yl)-6-(furan-2-yl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(-c2ccco2)c(N2CCCCCC2)nc1N |
| InChI | InChI=1S/C16H20N4O3/c1-22-16(21)13-14(17)19-15(20-8-4-2-3-5-9-20)12(18-13)11-7-6-10-23-11/h6-7,10H,2-5,8-9H2,1H3,(H2,17,19) |
| InChIKey | LIIZLCJWVJYPGZ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |