C9H5ClINO — CID 102974677
4-(4-chlorophenyl)-2-iodo-1,3-oxazole (PubChem CID 102974677) has the molecular formula C9H5ClINO and a molecular weight of 305.50 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-iodo-1,3-oxazole.
| Compound Name | 4-(4-chlorophenyl)-2-iodo-1,3-oxazole |
|---|---|
| PubChem CID | 102974677 |
| Molecular Formula | C9H5ClINO |
| Molecular Weight | 305.50 g/mol |
| Exact Mass | 304.91 |
| IUPAC Name | 4-(4-chlorophenyl)-2-iodo-1,3-oxazole |
| SMILES | Clc1ccc(-c2coc(I)n2)cc1 |
| InChI | InChI=1S/C9H5ClINO/c10-7-3-1-6(2-4-7)8-5-13-9(11)12-8/h1-5H |
| InChIKey | HPHVUPURWVQNIT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|