C10H6F2INO — CID 102974718
4-(2,5-difluoro-4-methylphenyl)-2-iodo-1,3-oxazole (PubChem CID 102974718) has the molecular formula C10H6F2INO and a molecular weight of 321.06 g/mol. Its IUPAC name is 4-(2,5-difluoro-4-methylphenyl)-2-iodo-1,3-oxazole.
| Compound Name | 4-(2,5-difluoro-4-methylphenyl)-2-iodo-1,3-oxazole |
|---|---|
| PubChem CID | 102974718 |
| Molecular Formula | C10H6F2INO |
| Molecular Weight | 321.06 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 4-(2,5-difluoro-4-methylphenyl)-2-iodo-1,3-oxazole |
| SMILES | Cc1cc(F)c(-c2coc(I)n2)cc1F |
| InChI | InChI=1S/C10H6F2INO/c1-5-2-8(12)6(3-7(5)11)9-4-15-10(13)14-9/h2-4H,1H3 |
| InChIKey | UQMXBYFOGFJLEY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.06 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|