C14H17N3O2S — CID 103001963
4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinolin-7-amine (PubChem CID 103001963) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinolin-7-amine.
| Compound Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinolin-7-amine |
|---|---|
| PubChem CID | 103001963 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 4-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)quinolin-7-amine |
| SMILES | CC1CS(=O)(=O)CCN1c1ccnc2cc(N)ccc12 |
| InChI | InChI=1S/C14H17N3O2S/c1-10-9-20(18,19)7-6-17(10)14-4-5-16-13-8-11(15)2-3-12(13)14/h2-5,8,10H,6-7,9,15H2,1H3 |
| InChIKey | WWJNGFVRVYASET-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|