C15H21N5 — CID 103003027
3-[N-[2-(2-methylpyrazol-3-yl)ethyl]anilino]propanimidamide (PubChem CID 103003027) has the molecular formula C15H21N5 and a molecular weight of 271.37 g/mol. Its IUPAC name is 3-[N-[2-(2-methylpyrazol-3-yl)ethyl]anilino]propanimidamide.
| Compound Name | 3-[N-[2-(2-methylpyrazol-3-yl)ethyl]anilino]propanimidamide |
|---|---|
| PubChem CID | 103003027 |
| Molecular Formula | C15H21N5 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | 3-[N-[2-(2-methylpyrazol-3-yl)ethyl]anilino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CCc1ccnn1C)c1ccccc1 |
| InChI | InChI=1S/C15H21N5/c1-19-13(7-10-18-19)8-11-20(12-9-15(16)17)14-5-3-2-4-6-14/h2-7,10H,8-9,11-12H2,1H3,(H3,16,17) |
| InChIKey | QFPRAQIGFVZATC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|