C9H17N5 — CID 61491625
3-[methyl(2-pyrazol-1-ylethyl)amino]propanimidamide (PubChem CID 61491625) has the molecular formula C9H17N5 and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-[methyl(2-pyrazol-1-ylethyl)amino]propanimidamide.
| Compound Name | 3-[methyl(2-pyrazol-1-ylethyl)amino]propanimidamide |
|---|---|
| PubChem CID | 61491625 |
| Molecular Formula | C9H17N5 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.15 |
| IUPAC Name | 3-[methyl(2-pyrazol-1-ylethyl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(C)CCn1cccn1 |
| InChI | InChI=1S/C9H17N5/c1-13(6-3-9(10)11)7-8-14-5-2-4-12-14/h2,4-5H,3,6-8H2,1H3,(H3,10,11) |
| InChIKey | PSJLIGWVXBLYIY-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|