C9H16N6O — CID 166884819
(2R)-2,4-diamino-4-imino-N-(2-pyrazol-1-ylethyl)butanamide (PubChem CID 166884819) has the molecular formula C9H16N6O and a molecular weight of 224.27 g/mol. Its IUPAC name is (2R)-2,4-diamino-4-imino-N-(2-pyrazol-1-ylethyl)butanamide.
| Compound Name | (2R)-2,4-diamino-4-imino-N-(2-pyrazol-1-ylethyl)butanamide |
|---|---|
| PubChem CID | 166884819 |
| Molecular Formula | C9H16N6O |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2R)-2,4-diamino-4-imino-N-(2-pyrazol-1-ylethyl)butanamide |
| SMILES | [H]/N=C(\N)C[C@@H](N)C(=O)NCCn1cccn1 |
| InChI | InChI=1S/C9H16N6O/c10-7(6-8(11)12)9(16)13-3-5-15-4-1-2-14-15/h1-2,4,7H,3,5-6,10H2,(H3,11,12)(H,13,16)/t7-/m1/s1 |
| InChIKey | GVIBUFHLUVKXPV-SSDOTTSWSA-N |
| XLogP | -1.35 |
| TPSA | 122.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|