C12H24N4 — CID 62592776
N'-methyl-N-(2-methylpropyl)-N'-(2-pyrazol-1-ylethyl)ethane-1,2-diamine (PubChem CID 62592776) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is N'-methyl-N-(2-methylpropyl)-N'-(2-pyrazol-1-ylethyl)ethane-1,2-diamine.
| Compound Name | N'-methyl-N-(2-methylpropyl)-N'-(2-pyrazol-1-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62592776 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | N'-methyl-N-(2-methylpropyl)-N'-(2-pyrazol-1-ylethyl)ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(C)CCn1cccn1 |
| InChI | InChI=1S/C12H24N4/c1-12(2)11-13-6-8-15(3)9-10-16-7-4-5-14-16/h4-5,7,12-13H,6,8-11H2,1-3H3 |
| InChIKey | CYCKEZDQAQURIG-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|