C14H15BrClF — CID 103051394
3-(bromomethyl)-3-[(5-chloro-2-fluorophenyl)methyl]bicyclo[3.1.0]hexane (PubChem CID 103051394) has the molecular formula C14H15BrClF and a molecular weight of 317.63 g/mol. Its IUPAC name is 3-(bromomethyl)-3-[(5-chloro-2-fluorophenyl)methyl]bicyclo[3.1.0]hexane.
| Compound Name | 3-(bromomethyl)-3-[(5-chloro-2-fluorophenyl)methyl]bicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 103051394 |
| Molecular Formula | C14H15BrClF |
| Molecular Weight | 317.63 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 3-(bromomethyl)-3-[(5-chloro-2-fluorophenyl)methyl]bicyclo[3.1.0]hexane |
| SMILES | Fc1ccc(Cl)cc1CC1(CBr)CC2CC2C1 |
| InChI | InChI=1S/C14H15BrClF/c15-8-14(5-9-3-10(9)6-14)7-11-4-12(16)1-2-13(11)17/h1-2,4,9-10H,3,5-8H2 |
| InChIKey | GZGOLNDHQUOLTF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|