C9H13ClN2S — CID 103066291
5-[2-(chloromethyl)prop-2-enylsulfanyl]-1,3-dimethylpyrazole (PubChem CID 103066291) has the molecular formula C9H13ClN2S and a molecular weight of 216.74 g/mol. Its IUPAC name is 5-[2-(chloromethyl)prop-2-enylsulfanyl]-1,3-dimethylpyrazole.
| Compound Name | 5-[2-(chloromethyl)prop-2-enylsulfanyl]-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 103066291 |
| Molecular Formula | C9H13ClN2S |
| Molecular Weight | 216.74 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 5-[2-(chloromethyl)prop-2-enylsulfanyl]-1,3-dimethylpyrazole |
| SMILES | C=C(CCl)CSc1cc(C)nn1C |
| InChI | InChI=1S/C9H13ClN2S/c1-7(5-10)6-13-9-4-8(2)11-12(9)3/h4H,1,5-6H2,2-3H3 |
| InChIKey | PQSFDWMJJQYXPH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|