C10H20N2O — CID 103069970
2-[cyclopropyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol (PubChem CID 103069970) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-[cyclopropyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol.
| Compound Name | 2-[cyclopropyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol |
|---|---|
| PubChem CID | 103069970 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-[cyclopropyl-[2-(methylaminomethyl)prop-2-enyl]amino]ethanol |
| SMILES | C=C(CNC)CN(CCO)C1CC1 |
| InChI | InChI=1S/C10H20N2O/c1-9(7-11-2)8-12(5-6-13)10-3-4-10/h10-11,13H,1,3-8H2,2H3 |
| InChIKey | MSYDFXVIJTVIFX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|