C9H17NO2S2 — CID 103073308
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol (PubChem CID 103073308) has the molecular formula C9H17NO2S2 and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 103073308 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO2S2/c1-8(6-13)5-10(2)9-3-4-14(11,12)7-9/h9,13H,1,3-7H2,2H3 |
| InChIKey | WKEJSFFWPULWMD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|