About 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol (PubChem CID 103073308) has the molecular formula C9H17NO2S2
and a molecular weight of 235.37 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol.
Molecular Properties
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol |
| PubChem CID | 103073308 |
| Molecular Formula | C9H17NO2S2 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol |
| SMILES | C=C(CS)CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H17NO2S2/c1-8(6-13)5-10(2)9-3-4-14(11,12)7-9/h9,13H,1,3-7H2,2H3 |
| InChIKey | WKEJSFFWPULWMD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol?
The IUPAC name of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol (CID 103073308) is 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol.
What is the SMILES notation for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol?
The canonical SMILES for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol is C=C(CS)CN(C)C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol?
The InChIKey is WKEJSFFWPULWMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S2/c1-8(6-13)5-10(2)9-3-4-14(11,12)7-9/h9,13H,1,3-7H2,2H3.
What are the key properties of 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol?
2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol has a molecular weight of 235.37 g/mol, XLogP of 0.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]prop-2-ene-1-thiol is sourced from PubChem (CID 103073308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).