C12H16N4 — CID 103077806
3-N-benzyl-3-N,1-dimethylpyrazole-3,4-diamine (PubChem CID 103077806) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 3-N-benzyl-3-N,1-dimethylpyrazole-3,4-diamine.
| Compound Name | 3-N-benzyl-3-N,1-dimethylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103077806 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-N-benzyl-3-N,1-dimethylpyrazole-3,4-diamine |
| SMILES | CN(Cc1ccccc1)c1nn(C)cc1N |
| InChI | InChI=1S/C12H16N4/c1-15(8-10-6-4-3-5-7-10)12-11(13)9-16(2)14-12/h3-7,9H,8,13H2,1-2H3 |
| InChIKey | NTCWHFLPESCEQD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |