C14H19N5 — CID 103077808
1-methyl-3-(4-phenylpiperazin-1-yl)pyrazol-4-amine (PubChem CID 103077808) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 1-methyl-3-(4-phenylpiperazin-1-yl)pyrazol-4-amine.
| Compound Name | 1-methyl-3-(4-phenylpiperazin-1-yl)pyrazol-4-amine |
|---|---|
| PubChem CID | 103077808 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 1-methyl-3-(4-phenylpiperazin-1-yl)pyrazol-4-amine |
| SMILES | Cn1cc(N)c(N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C14H19N5/c1-17-11-13(15)14(16-17)19-9-7-18(8-10-19)12-5-3-2-4-6-12/h2-6,11H,7-10,15H2,1H3 |
| InChIKey | FKIHPMQSDPQYJH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |