C11H13FN4 — CID 103077980
3-N-(2-fluoro-4-methylphenyl)-1-methylpyrazole-3,4-diamine (PubChem CID 103077980) has the molecular formula C11H13FN4 and a molecular weight of 220.25 g/mol. Its IUPAC name is 3-N-(2-fluoro-4-methylphenyl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(2-fluoro-4-methylphenyl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103077980 |
| Molecular Formula | C11H13FN4 |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3-N-(2-fluoro-4-methylphenyl)-1-methylpyrazole-3,4-diamine |
| SMILES | Cc1ccc(Nc2nn(C)cc2N)c(F)c1 |
| InChI | InChI=1S/C11H13FN4/c1-7-3-4-10(8(12)5-7)14-11-9(13)6-16(2)15-11/h3-6H,13H2,1-2H3,(H,14,15) |
| InChIKey | LJOOYAOOVSBSID-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |