C6H10F2N4 — CID 103078760
3-N-(2,2-difluoroethyl)-1-methylpyrazole-3,4-diamine (PubChem CID 103078760) has the molecular formula C6H10F2N4 and a molecular weight of 176.17 g/mol. Its IUPAC name is 3-N-(2,2-difluoroethyl)-1-methylpyrazole-3,4-diamine.
| Compound Name | 3-N-(2,2-difluoroethyl)-1-methylpyrazole-3,4-diamine |
|---|---|
| PubChem CID | 103078760 |
| Molecular Formula | C6H10F2N4 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3-N-(2,2-difluoroethyl)-1-methylpyrazole-3,4-diamine |
| SMILES | Cn1cc(N)c(NCC(F)F)n1 |
| InChI | InChI=1S/C6H10F2N4/c1-12-3-4(9)6(11-12)10-2-5(7)8/h3,5H,2,9H2,1H3,(H,10,11) |
| InChIKey | AHQKRGIKMWBKPC-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |