C9H16F3NO2S — CID 103089360
methyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate (PubChem CID 103089360) has the molecular formula C9H16F3NO2S and a molecular weight of 259.29 g/mol. Its IUPAC name is methyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate.
| Compound Name | methyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate |
|---|---|
| PubChem CID | 103089360 |
| Molecular Formula | C9H16F3NO2S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | methyl 5-methylsulfanyl-2-(2,2,2-trifluoroethylamino)pentanoate |
| SMILES | COC(=O)C(CCCSC)NCC(F)(F)F |
| InChI | InChI=1S/C9H16F3NO2S/c1-15-8(14)7(4-3-5-16-2)13-6-9(10,11)12/h7,13H,3-6H2,1-2H3 |
| InChIKey | ZONJAQFYOAHGLE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|