C11H15Br2NS — CID 103092752
(E)-4-(4,5-dibromothiophen-2-yl)-N-propylbut-3-en-2-amine (PubChem CID 103092752) has the molecular formula C11H15Br2NS and a molecular weight of 353.12 g/mol. Its IUPAC name is (E)-4-(4,5-dibromothiophen-2-yl)-N-propylbut-3-en-2-amine.
| Compound Name | (E)-4-(4,5-dibromothiophen-2-yl)-N-propylbut-3-en-2-amine |
|---|---|
| PubChem CID | 103092752 |
| Molecular Formula | C11H15Br2NS |
| Molecular Weight | 353.12 g/mol |
| Exact Mass | 350.93 |
| IUPAC Name | (E)-4-(4,5-dibromothiophen-2-yl)-N-propylbut-3-en-2-amine |
| SMILES | CCCNC(C)/C=C/c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C11H15Br2NS/c1-3-6-14-8(2)4-5-9-7-10(12)11(13)15-9/h4-5,7-8,14H,3,6H2,1-2H3/b5-4+ |
| InChIKey | XGRYGYPWHZJTTO-SNAWJCMRSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |