C6H6BrFN4O4 — CID 103098310
ethyl 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-fluoroacetate (PubChem CID 103098310) has the molecular formula C6H6BrFN4O4 and a molecular weight of 297.04 g/mol. Its IUPAC name is ethyl 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-fluoroacetate.
| Compound Name | ethyl 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-fluoroacetate |
|---|---|
| PubChem CID | 103098310 |
| Molecular Formula | C6H6BrFN4O4 |
| Molecular Weight | 297.04 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | ethyl 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-fluoroacetate |
| SMILES | CCOC(=O)C(F)n1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C6H6BrFN4O4/c1-2-16-4(13)3(8)11-5(7)9-6(10-11)12(14)15/h3H,2H2,1H3 |
| InChIKey | ZMFWTLRJTNTENE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.04 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|