C6H9BrN4O2S — CID 103099316
3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-methylpropane-1-thiol (PubChem CID 103099316) has the molecular formula C6H9BrN4O2S and a molecular weight of 281.14 g/mol. Its IUPAC name is 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-methylpropane-1-thiol.
| Compound Name | 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 103099316 |
| Molecular Formula | C6H9BrN4O2S |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 3-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-2-methylpropane-1-thiol |
| SMILES | CC(CS)Cn1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C6H9BrN4O2S/c1-4(3-14)2-10-5(7)8-6(9-10)11(12)13/h4,14H,2-3H2,1H3 |
| InChIKey | IHMDKVGGAAVKSR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|