C4H4N6O6 — CID 12649238
3,5-dinitro-1-(2-nitroethyl)-1,2,4-triazole (PubChem CID 12649238) has the molecular formula C4H4N6O6 and a molecular weight of 232.11 g/mol. Its IUPAC name is 3,5-dinitro-1-(2-nitroethyl)-1,2,4-triazole.
| Compound Name | 3,5-dinitro-1-(2-nitroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 12649238 |
| Molecular Formula | C4H4N6O6 |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 3,5-dinitro-1-(2-nitroethyl)-1,2,4-triazole |
| SMILES | O=[N+]([O-])CCn1nc([N+](=O)[O-])nc1[N+](=O)[O-] |
| InChI | InChI=1S/C4H4N6O6/c11-8(12)2-1-7-4(10(15)16)5-3(6-7)9(13)14/h1-2H2 |
| InChIKey | IHVHALWJDARBAC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 160.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|