C9H14Br2N4O2 — CID 103098393
5-bromo-1-[2-(bromomethyl)-3,3-dimethylbutyl]-3-nitro-1,2,4-triazole (PubChem CID 103098393) has the molecular formula C9H14Br2N4O2 and a molecular weight of 370.05 g/mol. Its IUPAC name is 5-bromo-1-[2-(bromomethyl)-3,3-dimethylbutyl]-3-nitro-1,2,4-triazole.
| Compound Name | 5-bromo-1-[2-(bromomethyl)-3,3-dimethylbutyl]-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 103098393 |
| Molecular Formula | C9H14Br2N4O2 |
| Molecular Weight | 370.05 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 5-bromo-1-[2-(bromomethyl)-3,3-dimethylbutyl]-3-nitro-1,2,4-triazole |
| SMILES | CC(C)(C)C(CBr)Cn1nc([N+](=O)[O-])nc1Br |
| InChI | InChI=1S/C9H14Br2N4O2/c1-9(2,3)6(4-10)5-14-7(11)12-8(13-14)15(16)17/h6H,4-5H2,1-3H3 |
| InChIKey | XZLPAFRQWIKFTJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.05 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|