C8H11BrN4O4 — CID 103098791
5-bromo-1-[2-(1,3-dioxan-2-yl)ethyl]-3-nitro-1,2,4-triazole (PubChem CID 103098791) has the molecular formula C8H11BrN4O4 and a molecular weight of 307.10 g/mol. Its IUPAC name is 5-bromo-1-[2-(1,3-dioxan-2-yl)ethyl]-3-nitro-1,2,4-triazole.
| Compound Name | 5-bromo-1-[2-(1,3-dioxan-2-yl)ethyl]-3-nitro-1,2,4-triazole |
|---|---|
| PubChem CID | 103098791 |
| Molecular Formula | C8H11BrN4O4 |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 5-bromo-1-[2-(1,3-dioxan-2-yl)ethyl]-3-nitro-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(Br)n(CCC2OCCCO2)n1 |
| InChI | InChI=1S/C8H11BrN4O4/c9-7-10-8(13(14)15)11-12(7)3-2-6-16-4-1-5-17-6/h6H,1-5H2 |
| InChIKey | GDQHEUTWMVWSMO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 92.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|