C7H10BrN5O2 — CID 103098775
5-bromo-3-nitro-1-[[(2S)-pyrrolidin-2-yl]methyl]-1,2,4-triazole (PubChem CID 103098775) has the molecular formula C7H10BrN5O2 and a molecular weight of 276.09 g/mol. Its IUPAC name is 5-bromo-3-nitro-1-[[(2S)-pyrrolidin-2-yl]methyl]-1,2,4-triazole.
| Compound Name | 5-bromo-3-nitro-1-[[(2S)-pyrrolidin-2-yl]methyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 103098775 |
| Molecular Formula | C7H10BrN5O2 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 275.00 |
| IUPAC Name | 5-bromo-3-nitro-1-[[(2S)-pyrrolidin-2-yl]methyl]-1,2,4-triazole |
| SMILES | O=[N+]([O-])c1nc(Br)n(C[C@@H]2CCCN2)n1 |
| InChI | InChI=1S/C7H10BrN5O2/c8-6-10-7(13(14)15)11-12(6)4-5-2-1-3-9-5/h5,9H,1-4H2/t5-/m0/s1 |
| InChIKey | YCNWGRPLWAKDJG-YFKPBYRVSA-N |
| XLogP | 0.70 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|